C23H37FN4O2 — CID 109446903
N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446903) has the molecular formula C23H37FN4O2 and a molecular weight of 420.57 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446903 |
| Molecular Formula | C23H37FN4O2 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccc(F)cc1)N(C)C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C23H37FN4O2/c1-25-23(26-16-22(27(2)3)18-7-9-19(24)10-8-18)28-13-11-20(12-14-28)30-17-21-6-4-5-15-29-21/h7-10,20-22H,4-6,11-17H2,1-3H3,(H,25,26) |
| InChIKey | PSSCRTWCIARPJN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|