C22H34FN3O3 — CID 109447139
N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447139) has the molecular formula C22H34FN3O3 and a molecular weight of 407.53 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447139 |
| Molecular Formula | C22H34FN3O3 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H34FN3O3/c1-2-24-22(25-15-21(27)17-6-8-18(23)9-7-17)26-12-10-19(11-13-26)29-16-20-5-3-4-14-28-20/h6-9,19-21,27H,2-5,10-16H2,1H3,(H,24,25) |
| InChIKey | OSFRPPDJOFLRHR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|