C24H35FN4O2 — CID 109450241
N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109450241) has the molecular formula C24H35FN4O2 and a molecular weight of 430.57 g/mol. Its IUPAC name is N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109450241 |
| Molecular Formula | C24H35FN4O2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccc(F)cc12)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C24H35FN4O2/c1-2-26-24(27-11-8-18-16-28-23-7-6-19(25)15-22(18)23)29-12-9-20(10-13-29)31-17-21-5-3-4-14-30-21/h6-7,15-16,20-21,28H,2-5,8-14,17H2,1H3,(H,26,27) |
| InChIKey | GDZGDGCOCWVBGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|