C23H38FIN4O2 — CID 109447188
N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447188) has the molecular formula C23H38FIN4O2 and a molecular weight of 548.49 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447188 |
| Molecular Formula | C23H38FIN4O2 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C)Cc1ccc(F)cc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C23H37FN4O2.HI/c1-25-23(26-12-15-27(2)17-19-6-8-20(24)9-7-19)28-13-10-21(11-14-28)30-18-22-5-3-4-16-29-22;/h6-9,21-22H,3-5,10-18H2,1-2H3,(H,25,26);1H |
| InChIKey | QYFAUGYZGDOXGV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|