C21H32F2IN3O2 — CID 109449754
N-[2-(3,5-difluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449754) has the molecular formula C21H32F2IN3O2 and a molecular weight of 523.41 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449754 |
| Molecular Formula | C21H32F2IN3O2 |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cc(F)cc(F)c1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C21H31F2N3O2.HI/c1-24-21(25-8-5-16-12-17(22)14-18(23)13-16)26-9-6-19(7-10-26)28-15-20-4-2-3-11-27-20;/h12-14,19-20H,2-11,15H2,1H3,(H,24,25);1H |
| InChIKey | NMXKFIGOTMAMQA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|