C19H30ClN3O2S — CID 109446785
N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446785) has the molecular formula C19H30ClN3O2S and a molecular weight of 399.99 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446785 |
| Molecular Formula | C19H30ClN3O2S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1ccc(Cl)s1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C19H30ClN3O2S/c1-21-19(22-10-7-17-5-6-18(20)26-17)23-11-8-15(9-12-23)25-14-16-4-2-3-13-24-16/h5-6,15-16H,2-4,7-14H2,1H3,(H,21,22) |
| InChIKey | KYDSJGKIVCWBAO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|