C18H28BrN3O2S — CID 109448829
N-[(5-bromothiophen-2-yl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448829) has the molecular formula C18H28BrN3O2S and a molecular weight of 430.41 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448829 |
| Molecular Formula | C18H28BrN3O2S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(Br)s1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H28BrN3O2S/c1-20-18(21-12-16-5-6-17(19)25-16)22-9-7-14(8-10-22)24-13-15-4-2-3-11-23-15/h5-6,14-15H,2-4,7-13H2,1H3,(H,20,21) |
| InChIKey | QLKKFGGNFLZHPX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|