C18H30IN3O3 — CID 109447400
N-(furan-2-ylmethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447400) has the molecular formula C18H30IN3O3 and a molecular weight of 463.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(furan-2-ylmethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447400 |
| Molecular Formula | C18H30IN3O3 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccco1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C18H29N3O3.HI/c1-19-18(20-13-16-6-4-12-22-16)21-9-7-15(8-10-21)24-14-17-5-2-3-11-23-17;/h4,6,12,15,17H,2-3,5,7-11,13-14H2,1H3,(H,19,20);1H |
| InChIKey | HVJOYACXGVGTHP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|