C20H30F2IN3O2 — CID 109448780
N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448780) has the molecular formula C20H30F2IN3O2 and a molecular weight of 509.38 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448780 |
| Molecular Formula | C20H30F2IN3O2 |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cc(F)ccc1F)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C20H29F2N3O2.HI/c1-23-20(24-13-15-12-16(21)5-6-19(15)22)25-9-7-17(8-10-25)27-14-18-4-2-3-11-26-18;/h5-6,12,17-18H,2-4,7-11,13-14H2,1H3,(H,23,24);1H |
| InChIKey | PNWGIIZQWSTDGM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|