C23H36IN3O3 — CID 109450058
N'-methyl-4-(oxan-2-ylmethoxy)-N-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109450058) has the molecular formula C23H36IN3O3 and a molecular weight of 529.46 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450058 |
| Molecular Formula | C23H36IN3O3 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C23H35N3O3.HI/c1-3-15-28-22-10-5-4-8-19(22)17-25-23(24-2)26-13-11-20(12-14-26)29-18-21-9-6-7-16-27-21;/h3-5,8,10,20-21H,1,6-7,9,11-18H2,2H3,(H,24,25);1H |
| InChIKey | WGOBSCRKUSMLTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|