C21H33ClIN3O2 — CID 109446754
N-[2-(2-chlorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109446754) has the molecular formula C21H33ClIN3O2 and a molecular weight of 521.87 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109446754 |
| Molecular Formula | C21H33ClIN3O2 |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1Cl)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C21H32ClN3O2.HI/c1-23-21(24-12-9-17-6-2-3-8-20(17)22)25-13-10-18(11-14-25)27-16-19-7-4-5-15-26-19;/h2-3,6,8,18-19H,4-5,7,9-16H2,1H3,(H,23,24);1H |
| InChIKey | YUMIQMGSTOBUTC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|