C25H38N4O2 — CID 109449171
N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109449171) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449171 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCc1cccc2c(CCN/C(=N/C)N3CCC(OCC4CCCCO4)CC3)c[nH]c12 |
| InChI | InChI=1S/C25H38N4O2/c1-3-19-7-6-9-23-20(17-28-24(19)23)10-13-27-25(26-2)29-14-11-21(12-15-29)31-18-22-8-4-5-16-30-22/h6-7,9,17,21-22,28H,3-5,8,10-16,18H2,1-2H3,(H,26,27) |
| InChIKey | GTFPXSQINOTLAS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|