C21H31ClFN3O2 — CID 109449159
N-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109449159) has the molecular formula C21H31ClFN3O2 and a molecular weight of 411.95 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449159 |
| Molecular Formula | C21H31ClFN3O2 |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1c(F)cccc1Cl)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H31ClFN3O2/c1-24-21(25-11-8-18-19(22)6-4-7-20(18)23)26-12-9-16(10-13-26)28-15-17-5-2-3-14-27-17/h4,6-7,16-17H,2-3,5,8-15H2,1H3,(H,24,25) |
| InChIKey | VXRGMGNXEICKNK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|