C21H31Cl2N3O3 — CID 109447967
N-[2-(2,3-dichlorophenoxy)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447967) has the molecular formula C21H31Cl2N3O3 and a molecular weight of 444.40 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenoxy)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-(2,3-dichlorophenoxy)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447967 |
| Molecular Formula | C21H31Cl2N3O3 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[2-(2,3-dichlorophenoxy)ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCOc1cccc(Cl)c1Cl)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H31Cl2N3O3/c1-24-21(25-10-14-28-19-7-4-6-18(22)20(19)23)26-11-8-16(9-12-26)29-15-17-5-2-3-13-27-17/h4,6-7,16-17H,2-3,5,8-15H2,1H3,(H,24,25) |
| InChIKey | UBTZWFYZOKSJAS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|