C18H26N4 — CID 111117711
N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111117711) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111117711 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | CCc1cccc2c(CCN/C(=N/C)N3CCCC3)c[nH]c12 |
| InChI | InChI=1S/C18H26N4/c1-3-14-7-6-8-16-15(13-21-17(14)16)9-10-20-18(19-2)22-11-4-5-12-22/h6-8,13,21H,3-5,9-12H2,1-2H3,(H,19,20) |
| InChIKey | YFNRSXUFAPMAQB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|