C21H27N5 — CID 111835793
1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111835793) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111835793 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCc1cccc2c(CCN/C(=N/C)NCCc3ccccn3)c[nH]c12 |
| InChI | InChI=1S/C21H27N5/c1-3-16-7-6-9-19-17(15-26-20(16)19)10-13-24-21(22-2)25-14-11-18-8-4-5-12-23-18/h4-9,12,15,26H,3,10-11,13-14H2,1-2H3,(H2,22,24,25) |
| InChIKey | UXXLMQJIPBDWHQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|