C22H29N5 — CID 109407356
1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109407356) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109407356 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | CCc1cccc2c(CCN/C(=N/C)NCCc3ccncc3C)c[nH]c12 |
| InChI | InChI=1S/C22H29N5/c1-4-17-6-5-7-20-19(15-27-21(17)20)10-13-26-22(23-3)25-12-9-18-8-11-24-14-16(18)2/h5-8,11,14-15,27H,4,9-10,12-13H2,1-3H3,(H2,23,25,26) |
| InChIKey | TYFXDECKEPEOHF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|