C22H35N5 — CID 111834479
1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111834479) has the molecular formula C22H35N5 and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111834479 |
| Molecular Formula | C22H35N5 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 1-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCCc2c[nH]c3c(CC)cccc23)CC1 |
| InChI | InChI=1S/C22H35N5/c1-4-13-27-14-10-19(11-15-27)26-22(23-3)24-12-9-18-16-25-21-17(5-2)7-6-8-20(18)21/h6-8,16,19,25H,4-5,9-15H2,1-3H3,(H2,23,24,26) |
| InChIKey | SXVJZSCXVYUAJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|