C22H35FIN3O3 — CID 109449174
N-[(4-ethoxy-3-fluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449174) has the molecular formula C22H35FIN3O3 and a molecular weight of 535.44 g/mol. Its IUPAC name is N-[(4-ethoxy-3-fluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-ethoxy-3-fluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449174 |
| Molecular Formula | C22H35FIN3O3 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N-[(4-ethoxy-3-fluorophenyl)methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1ccc(CN/C(=N/C)N2CCC(OCC3CCCCO3)CC2)cc1F.I |
| InChI | InChI=1S/C22H34FN3O3.HI/c1-3-27-21-8-7-17(14-20(21)23)15-25-22(24-2)26-11-9-18(10-12-26)29-16-19-6-4-5-13-28-19;/h7-8,14,18-19H,3-6,9-13,15-16H2,1-2H3,(H,24,25);1H |
| InChIKey | AZEIRBKCANFJHW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|