C22H33F2N3O4 — CID 109449795
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109449795) has the molecular formula C22H33F2N3O4 and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449795 |
| Molecular Formula | C22H33F2N3O4 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H33F2N3O4/c1-25-22(26-14-16-6-7-19(28-2)20(13-16)31-21(23)24)27-10-8-17(9-11-27)30-15-18-5-3-4-12-29-18/h6-7,13,17-18,21H,3-5,8-12,14-15H2,1-2H3,(H,25,26) |
| InChIKey | IQTDRFHQPMEBSM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|