C21H32F2IN3O3 — CID 109448866
N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448866) has the molecular formula C21H32F2IN3O3 and a molecular weight of 539.41 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448866 |
| Molecular Formula | C21H32F2IN3O3 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OC(F)F)c1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C21H31F2N3O3.HI/c1-24-21(25-14-16-5-4-7-18(13-16)29-20(22)23)26-10-8-17(9-11-26)28-15-19-6-2-3-12-27-19;/h4-5,7,13,17,19-20H,2-3,6,8-12,14-15H2,1H3,(H,24,25);1H |
| InChIKey | USSRFSOGBSDNGS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|