C20H32N4O4S — CID 109446893
N'-methyl-4-(oxan-2-ylmethoxy)-N-[(3-sulfamoylphenyl)methyl]piperidine-1-carboximidamide (PubChem CID 109446893) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-[(3-sulfamoylphenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[(3-sulfamoylphenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446893 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[(3-sulfamoylphenyl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-22-20(23-14-16-5-4-7-19(13-16)29(21,25)26)24-10-8-17(9-11-24)28-15-18-6-2-3-12-27-18/h4-5,7,13,17-18H,2-3,6,8-12,14-15H2,1H3,(H,22,23)(H2,21,25,26) |
| InChIKey | VQYQVFQHOBMEMG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|