C24H40IN3O4 — CID 109446640
N-[[3-(3-methoxypropoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109446640) has the molecular formula C24H40IN3O4 and a molecular weight of 561.51 g/mol. Its IUPAC name is N-[[3-(3-methoxypropoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(3-methoxypropoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109446640 |
| Molecular Formula | C24H40IN3O4 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N-[[3-(3-methoxypropoxy)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCCCOC)c1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H39N3O4.HI/c1-25-24(26-18-20-7-5-9-22(17-20)29-16-6-14-28-2)27-12-10-21(11-13-27)31-19-23-8-3-4-15-30-23;/h5,7,9,17,21,23H,3-4,6,8,10-16,18-19H2,1-2H3,(H,25,26);1H |
| InChIKey | IFLYLMFGDQYVHH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|