C24H36IN5O2 — CID 109450204
N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109450204) has the molecular formula C24H36IN5O2 and a molecular weight of 553.49 g/mol. Its IUPAC name is N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450204 |
| Molecular Formula | C24H36IN5O2 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2)c1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H35N5O2.HI/c1-25-24(27-16-20-5-4-6-21(15-20)17-28-13-10-26-19-28)29-11-8-22(9-12-29)31-18-23-7-2-3-14-30-23;/h4-6,10,13,15,19,22-23H,2-3,7-9,11-12,14,16-18H2,1H3,(H,25,27);1H |
| InChIKey | NLDLNFYZJYBWSD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|