C25H41N3O4 — CID 109447415
N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447415) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447415 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCOCCOCc1cccc(CN/C(=N\C)N2CCC(OCC3CCCCO3)CC2)c1 |
| InChI | InChI=1S/C25H41N3O4/c1-3-29-15-16-30-19-22-8-6-7-21(17-22)18-27-25(26-2)28-12-10-23(11-13-28)32-20-24-9-4-5-14-31-24/h6-8,17,23-24H,3-5,9-16,18-20H2,1-2H3,(H,26,27) |
| InChIKey | ZHOMDGBTJBZXKT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|