C24H40IN3O3 — CID 109447896
N'-methyl-4-(oxan-2-ylmethoxy)-N-(4-phenylmethoxybutyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447896) has the molecular formula C24H40IN3O3 and a molecular weight of 545.51 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-(4-phenylmethoxybutyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(4-phenylmethoxybutyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447896 |
| Molecular Formula | C24H40IN3O3 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(4-phenylmethoxybutyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCOCc1ccccc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H39N3O3.HI/c1-25-24(26-14-6-8-17-28-19-21-9-3-2-4-10-21)27-15-12-22(13-16-27)30-20-23-11-5-7-18-29-23;/h2-4,9-10,22-23H,5-8,11-20H2,1H3,(H,25,26);1H |
| InChIKey | ITHFPVQLDAJCOB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|