C20H38IN3O3 — CID 109447330
N-[3-(cyclopropylmethoxy)propyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447330) has the molecular formula C20H38IN3O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447330 |
| Molecular Formula | C20H38IN3O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C20H37N3O3.HI/c1-21-20(22-10-4-13-24-15-17-6-7-17)23-11-8-18(9-12-23)26-16-19-5-2-3-14-25-19;/h17-19H,2-16H2,1H3,(H,21,22);1H |
| InChIKey | XYAFQHYEUVDZGR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|