C22H36IN3O2S — CID 109448364
N'-methyl-4-(oxan-2-ylmethoxy)-N-(3-phenylsulfanylpropyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448364) has the molecular formula C22H36IN3O2S and a molecular weight of 533.52 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-(3-phenylsulfanylpropyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(3-phenylsulfanylpropyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448364 |
| Molecular Formula | C22H36IN3O2S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(3-phenylsulfanylpropyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCSc1ccccc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C22H35N3O2S.HI/c1-23-22(24-13-7-17-28-21-9-3-2-4-10-21)25-14-11-19(12-15-25)27-18-20-8-5-6-16-26-20;/h2-4,9-10,19-20H,5-8,11-18H2,1H3,(H,23,24);1H |
| InChIKey | VFLWZSRTWKHMNC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|