C25H40N4O3 — CID 109447431
N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447431) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447431 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccccc1)N1CCOCC1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C25H40N4O3/c1-26-25(29-12-10-22(11-13-29)32-20-23-9-5-6-16-31-23)27-19-24(21-7-3-2-4-8-21)28-14-17-30-18-15-28/h2-4,7-8,22-24H,5-6,9-20H2,1H3,(H,26,27) |
| InChIKey | OVYKYZDJRSVLAP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|