C24H33IN4O — CID 111722762
N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111722762) has the molecular formula C24H33IN4O and a molecular weight of 520.46 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111722762 |
| Molecular Formula | C24H33IN4O |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccccc1)N1CCOCC1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C24H32N4O.HI/c1-25-24(28-13-12-22(19-28)20-8-4-2-5-9-20)26-18-23(21-10-6-3-7-11-21)27-14-16-29-17-15-27;/h2-11,22-23H,12-19H2,1H3,(H,25,26);1H |
| InChIKey | SOBBHSHLDWGWJH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|