C26H37IN4O2 — CID 111526019
N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111526019) has the molecular formula C26H37IN4O2 and a molecular weight of 564.51 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111526019 |
| Molecular Formula | C26H37IN4O2 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccccc1)N1CCOCC1)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C26H36N4O2.HI/c1-27-26(30-13-12-23(19-30)21-32-20-22-8-4-2-5-9-22)28-18-25(24-10-6-3-7-11-24)29-14-16-31-17-15-29;/h2-11,23,25H,12-21H2,1H3,(H,27,28);1H |
| InChIKey | RTFYXUVCFIHGIL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|