C22H35FN4O3 — CID 111746888
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111746888) has the molecular formula C22H35FN4O3 and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111746888 |
| Molecular Formula | C22H35FN4O3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(c1cccc(F)c1)N1CCOCC1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C22H35FN4O3/c1-24-22(27-7-6-18(16-27)17-30-13-12-28-2)25-15-21(26-8-10-29-11-9-26)19-4-3-5-20(23)14-19/h3-5,14,18,21H,6-13,15-17H2,1-2H3,(H,24,25) |
| InChIKey | GIYXBDPHEILBCN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|