C21H36N4O4 — CID 111747967
3-(2-methoxyethoxymethyl)-N'-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrrolidine-1-carboximidamide (PubChem CID 111747967) has the molecular formula C21H36N4O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747967 |
| Molecular Formula | C21H36N4O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(c1ccc(C)o1)N1CCOCC1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C21H36N4O4/c1-17-4-5-20(29-17)19(24-8-10-27-11-9-24)14-23-21(22-2)25-7-6-18(15-25)16-28-13-12-26-3/h4-5,18-19H,6-16H2,1-3H3,(H,22,23) |
| InChIKey | KISBEXITTOWEFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|