C22H30FN7O — CID 111207552
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207552) has the molecular formula C22H30FN7O and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207552 |
| Molecular Formula | C22H30FN7O |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1cccc(F)c1)N1CCOCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H30FN7O/c1-24-21(29-8-10-30(11-9-29)22-25-6-3-7-26-22)27-17-20(28-12-14-31-15-13-28)18-4-2-5-19(23)16-18/h2-7,16,20H,8-15,17H2,1H3,(H,24,27) |
| InChIKey | PUSROKYFSZBQNZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|