C22H29F2N5OS — CID 109450457
4-(2,5-difluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide (PubChem CID 109450457) has the molecular formula C22H29F2N5OS and a molecular weight of 449.57 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450457 |
| Molecular Formula | C22H29F2N5OS |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCOCC1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H29F2N5OS/c1-25-22(26-16-20(21-3-2-14-31-21)28-10-12-30-13-11-28)29-8-6-27(7-9-29)19-15-17(23)4-5-18(19)24/h2-5,14-15,20H,6-13,16H2,1H3,(H,25,26) |
| InChIKey | VJPQUVPBQLUIBZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|