C22H30FN5OS — CID 111148159
4-(2-fluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide (PubChem CID 111148159) has the molecular formula C22H30FN5OS and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148159 |
| Molecular Formula | C22H30FN5OS |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCOCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H30FN5OS/c1-24-22(28-10-8-26(9-11-28)19-6-3-2-5-18(19)23)25-17-20(21-7-4-16-30-21)27-12-14-29-15-13-27/h2-7,16,20H,8-15,17H2,1H3,(H,24,25) |
| InChIKey | JRVAEDVRJULTIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|