C16H26N4OS — CID 110933601
N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrrolidine-1-carboximidamide (PubChem CID 110933601) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110933601 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(c1cccs1)N1CCOCC1)N1CCCC1 |
| InChI | InChI=1S/C16H26N4OS/c1-17-16(20-6-2-3-7-20)18-13-14(15-5-4-12-22-15)19-8-10-21-11-9-19/h4-5,12,14H,2-3,6-11,13H2,1H3,(H,17,18) |
| InChIKey | XOJCENKFIWNERG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|