C15H23N3O2S — CID 94494130
N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyrrolidine-1-carboxamide (PubChem CID 94494130) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94494130 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCOCC1)N1CCCC1 |
| InChI | InChI=1S/C15H23N3O2S/c19-15(18-5-1-2-6-18)16-12-13(14-4-3-11-21-14)17-7-9-20-10-8-17/h3-4,11,13H,1-2,5-10,12H2,(H,16,19)/t13-/m0/s1 |
| InChIKey | JNPVPJBVVHDSBE-ZDUSSCGKSA-N |
| XLogP | 1.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |