C16H25N3O2S — CID 119829137
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperidine-3-carboxamide (PubChem CID 119829137) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119829137 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)C1CCCNC1 |
| InChI | InChI=1S/C16H25N3O2S/c20-16(13-3-1-5-17-11-13)18-12-14(15-4-2-10-22-15)19-6-8-21-9-7-19/h2,4,10,13-14,17H,1,3,5-9,11-12H2,(H,18,20) |
| InChIKey | HCYSCXDLTWZDKT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |