C18H29Cl2N3O2 — CID 119849719
N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119849719) has the molecular formula C18H29Cl2N3O2 and a molecular weight of 390.36 g/mol. Its IUPAC name is N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119849719 |
| Molecular Formula | C18H29Cl2N3O2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cc1cccc(C(CNC(=O)C2CCNC2)N2CCOCC2)c1.Cl.Cl |
| InChI | InChI=1S/C18H27N3O2.2ClH/c1-14-3-2-4-15(11-14)17(21-7-9-23-10-8-21)13-20-18(22)16-5-6-19-12-16;;/h2-4,11,16-17,19H,5-10,12-13H2,1H3,(H,20,22);2*1H |
| InChIKey | DGOPXIQKONQWHZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |