C17H26Cl2FN3O3 — CID 119866007
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119866007) has the molecular formula C17H26Cl2FN3O3 and a molecular weight of 410.32 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119866007 |
| Molecular Formula | C17H26Cl2FN3O3 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC(c1cccc(F)c1)N1CCOCC1)C1CNCCO1 |
| InChI | InChI=1S/C17H24FN3O3.2ClH/c18-14-3-1-2-13(10-14)15(21-5-8-23-9-6-21)11-20-17(22)16-12-19-4-7-24-16;;/h1-3,10,15-16,19H,4-9,11-12H2,(H,20,22);2*1H |
| InChIKey | NPRXEXPWRXRPEA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |