C17H19FN2O2S — CID 47081662
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide (PubChem CID 47081662) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47081662 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(c1cccc(F)c1)N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C17H19FN2O2S/c18-14-4-1-3-13(11-14)15(20-6-8-22-9-7-20)12-19-17(21)16-5-2-10-23-16/h1-5,10-11,15H,6-9,12H2,(H,19,21) |
| InChIKey | DURAQQMVNYYBHQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |