C16H19FN2O3S2 — CID 52507194
N-[(2R)-2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 52507194) has the molecular formula C16H19FN2O3S2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[(2R)-2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(2R)-2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 52507194 |
| Molecular Formula | C16H19FN2O3S2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[(2R)-2-(3-fluorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1cccc(F)c1)N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C16H19FN2O3S2/c17-14-4-1-3-13(11-14)15(19-6-8-22-9-7-19)12-18-24(20,21)16-5-2-10-23-16/h1-5,10-11,15,18H,6-9,12H2/t15-/m0/s1 |
| InChIKey | PWCIWYKUGIDWDD-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |