C17H22N2O4S2 — CID 112504149
N-[2-(2-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 112504149) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112504149 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[2-(2-methoxyphenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccccc1C(CNS(=O)(=O)c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-22-16-6-3-2-5-14(16)15(19-8-10-23-11-9-19)13-18-25(20,21)17-7-4-12-24-17/h2-7,12,15,18H,8-11,13H2,1H3 |
| InChIKey | MHVBJFYEMQUHJP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |