C20H25BrN2O4S — CID 134017257
5-bromo-2-methoxy-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 134017257) has the molecular formula C20H25BrN2O4S and a molecular weight of 469.40 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134017257 |
| Molecular Formula | C20H25BrN2O4S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 5-bromo-2-methoxy-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | COc1ccccc1C(CNS(=O)(=O)c1cc(Br)ccc1OC)N1CCCC1 |
| InChI | InChI=1S/C20H25BrN2O4S/c1-26-18-8-4-3-7-16(18)17(23-11-5-6-12-23)14-22-28(24,25)20-13-15(21)9-10-19(20)27-2/h3-4,7-10,13,17,22H,5-6,11-12,14H2,1-2H3 |
| InChIKey | GKOKNRONGQLGPE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |