C17H22N2O3S2 — CID 47006058
N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide (PubChem CID 47006058) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 47006058 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccccc1C(CNS(=O)(=O)c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-22-16-8-3-2-7-14(16)15(19-10-4-5-11-19)13-18-24(20,21)17-9-6-12-23-17/h2-3,6-9,12,15,18H,4-5,10-11,13H2,1H3 |
| InChIKey | QCJAJNJWROKFJL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |