C24H34N2O5S — CID 52697516
3,4-diethoxy-N-[(2R)-2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzenesulfonamide (PubChem CID 52697516) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(2R)-2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-[(2R)-2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 52697516 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 3,4-diethoxy-N-[(2R)-2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC[C@@H](c2ccccc2OC)N2CCCCC2)cc1OCC |
| InChI | InChI=1S/C24H34N2O5S/c1-4-30-23-14-13-19(17-24(23)31-5-2)32(27,28)25-18-21(26-15-9-6-10-16-26)20-11-7-8-12-22(20)29-3/h7-8,11-14,17,21,25H,4-6,9-10,15-16,18H2,1-3H3/t21-/m0/s1 |
| InChIKey | LTJLXEUWYLJKIK-NRFANRHFSA-N |
| XLogP | 4.00 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |