C23H32N2O5S — CID 55386939
3,4-diethoxy-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 55386939) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55386939 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3,4-diethoxy-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(c2cccc(OC)c2)N2CCCC2)cc1OCC |
| InChI | InChI=1S/C23H32N2O5S/c1-4-29-22-12-11-20(16-23(22)30-5-2)31(26,27)24-17-21(25-13-6-7-14-25)18-9-8-10-19(15-18)28-3/h8-12,15-16,21,24H,4-7,13-14,17H2,1-3H3 |
| InChIKey | BFXPJUBHLMITDN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |