C21H30N2O3S2 — CID 16933273
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-4-ethoxy-3-methylbenzenesulfonamide (PubChem CID 16933273) has the molecular formula C21H30N2O3S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-4-ethoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-4-ethoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 16933273 |
| Molecular Formula | C21H30N2O3S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-4-ethoxy-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(c2ccsc2)N2CCCCCC2)cc1C |
| InChI | InChI=1S/C21H30N2O3S2/c1-3-26-21-9-8-19(14-17(21)2)28(24,25)22-15-20(18-10-13-27-16-18)23-11-6-4-5-7-12-23/h8-10,13-14,16,20,22H,3-7,11-12,15H2,1-2H3 |
| InChIKey | GYNLABRBQIYMIN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |