C17H21BrN2O2S2 — CID 16932837
4-bromo-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 16932837) has the molecular formula C17H21BrN2O2S2 and a molecular weight of 429.41 g/mol. Its IUPAC name is 4-bromo-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16932837 |
| Molecular Formula | C17H21BrN2O2S2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 4-bromo-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccsc1)N1CCCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrN2O2S2/c18-15-4-6-16(7-5-15)24(21,22)19-12-17(14-8-11-23-13-14)20-9-2-1-3-10-20/h4-8,11,13,17,19H,1-3,9-10,12H2 |
| InChIKey | XCWZKZGEYMPKOR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |